C14H18N2O3 — CID 86035175
methyl 5-(5-pyridin-4-yl-4,5-dihydro-1,2-oxazol-3-yl)pentanoate (PubChem CID 86035175) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is methyl 5-(5-pyridin-4-yl-4,5-dihydro-1,2-oxazol-3-yl)pentanoate.
| Compound Name | methyl 5-(5-pyridin-4-yl-4,5-dihydro-1,2-oxazol-3-yl)pentanoate |
|---|---|
| PubChem CID | 86035175 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | methyl 5-(5-pyridin-4-yl-4,5-dihydro-1,2-oxazol-3-yl)pentanoate |
| SMILES | COC(=O)CCCCC1=NOC(c2ccncc2)C1 |
| InChI | InChI=1S/C14H18N2O3/c1-18-14(17)5-3-2-4-12-10-13(19-16-12)11-6-8-15-9-7-11/h6-9,13H,2-5,10H2,1H3 |
| InChIKey | NJODVVAMCDXTHO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|