C16H21NO3 — CID 7319750
methyl 4-[(5S)-3-pentyl-4,5-dihydro-1,2-oxazol-5-yl]benzoate (PubChem CID 7319750) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is methyl 4-[(5S)-3-pentyl-4,5-dihydro-1,2-oxazol-5-yl]benzoate.
| Compound Name | methyl 4-[(5S)-3-pentyl-4,5-dihydro-1,2-oxazol-5-yl]benzoate |
|---|---|
| PubChem CID | 7319750 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | methyl 4-[(5S)-3-pentyl-4,5-dihydro-1,2-oxazol-5-yl]benzoate |
| SMILES | CCCCCC1=NO[C@H](c2ccc(C(=O)OC)cc2)C1 |
| InChI | InChI=1S/C16H21NO3/c1-3-4-5-6-14-11-15(20-17-14)12-7-9-13(10-8-12)16(18)19-2/h7-10,15H,3-6,11H2,1-2H3/t15-/m0/s1 |
| InChIKey | BETCCIHVNWIDES-HNNXBMFYSA-N |
| XLogP | 3.87 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|