4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid

C20H21NO3 — CID 90698839

IUPAC4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid
SMILESCCCCc1ccc(C2=NOC(c3ccc(C(=O)O)cc3)C2)cc1
InChIInChI=1S/C20H21NO3/c1-2-3-4-14-5-7-15(8-6-14)18-13-19(24-21-18)16-9-11-17(12-10-16)20(22)23/h5-12,19H,2-4,13H2,1H3,(H,22,23)
InChIKeyODUXQRJXVJNAAA-UHFFFAOYSA-N
MW323.39 g/mol
LogP4.59
Rot. Bonds6

About 4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid

4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid (PubChem CID 90698839) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid.

Molecular Properties

Compound Name4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid
PubChem CID90698839
Molecular FormulaC20H21NO3
Molecular Weight323.39 g/mol
Exact Mass323.15
IUPAC Name4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid
SMILESCCCCc1ccc(C2=NOC(c3ccc(C(=O)O)cc3)C2)cc1
InChIInChI=1S/C20H21NO3/c1-2-3-4-14-5-7-15(8-6-14)18-13-19(24-21-18)16-9-11-17(12-10-16)20(22)23/h5-12,19H,2-4,13H2,1H3,(H,22,23)
InChIKeyODUXQRJXVJNAAA-UHFFFAOYSA-N
XLogP4.59
TPSA58.89 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500323.39
LogP ≤ 54.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid?
The IUPAC name of 4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid (CID 90698839) is 4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid.
What is the SMILES notation for 4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid?
The canonical SMILES for 4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid is CCCCc1ccc(C2=NOC(c3ccc(C(=O)O)cc3)C2)cc1.
What is the InChIKey of 4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid?
The InChIKey is ODUXQRJXVJNAAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21NO3/c1-2-3-4-14-5-7-15(8-6-14)18-13-19(24-21-18)16-9-11-17(12-10-16)20(22)23/h5-12,19H,2-4,13H2,1H3,(H,22,23).
What are the key properties of 4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid?
4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid has a molecular weight of 323.39 g/mol, XLogP of 4.59, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid is sourced from PubChem (CID 90698839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).