C20H21NO3 — CID 90698839
4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid (PubChem CID 90698839) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is 4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid.
| Compound Name | 4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid |
|---|---|
| PubChem CID | 90698839 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 4-[3-(4-butylphenyl)-4,5-dihydro-1,2-oxazol-5-yl]benzoic acid |
| SMILES | CCCCc1ccc(C2=NOC(c3ccc(C(=O)O)cc3)C2)cc1 |
| InChI | InChI=1S/C20H21NO3/c1-2-3-4-14-5-7-15(8-6-14)18-13-19(24-21-18)16-9-11-17(12-10-16)20(22)23/h5-12,19H,2-4,13H2,1H3,(H,22,23) |
| InChIKey | ODUXQRJXVJNAAA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |