C20H19NO3 — CID 67379228
4-[4-(4-butylphenyl)-1,2-oxazol-3-yl]benzoic acid (PubChem CID 67379228) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 4-[4-(4-butylphenyl)-1,2-oxazol-3-yl]benzoic acid.
| Compound Name | 4-[4-(4-butylphenyl)-1,2-oxazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 67379228 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 4-[4-(4-butylphenyl)-1,2-oxazol-3-yl]benzoic acid |
| SMILES | CCCCc1ccc(-c2conc2-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C20H19NO3/c1-2-3-4-14-5-7-15(8-6-14)18-13-24-21-19(18)16-9-11-17(12-10-16)20(22)23/h5-13H,2-4H2,1H3,(H,22,23) |
| InChIKey | YKYBVEAKWUSAHI-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |