C22H20N2O4 — CID 138532302
4-[5-butyl-3-(4-carboxyphenyl)pyrazin-2-yl]benzoic acid (PubChem CID 138532302) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 4-[5-butyl-3-(4-carboxyphenyl)pyrazin-2-yl]benzoic acid.
| Compound Name | 4-[5-butyl-3-(4-carboxyphenyl)pyrazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 138532302 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 4-[5-butyl-3-(4-carboxyphenyl)pyrazin-2-yl]benzoic acid |
| SMILES | CCCCc1cnc(-c2ccc(C(=O)O)cc2)c(-c2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C22H20N2O4/c1-2-3-4-18-13-23-19(14-5-9-16(10-6-14)21(25)26)20(24-18)15-7-11-17(12-8-15)22(27)28/h5-13H,2-4H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | GLCKHIPRPZPKQA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |