C14H21NO3 — CID 11276789
methyl 5-[(1R,2S,6S,7S)-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-en-5-yl]pentanoate (PubChem CID 11276789) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is methyl 5-[(1R,2S,6S,7S)-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-en-5-yl]pentanoate.
| Compound Name | methyl 5-[(1R,2S,6S,7S)-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-en-5-yl]pentanoate |
|---|---|
| PubChem CID | 11276789 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | methyl 5-[(1R,2S,6S,7S)-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-en-5-yl]pentanoate |
| SMILES | COC(=O)CCCCC1=NO[C@H]2[C@@H]3CC[C@@H](C3)[C@@H]12 |
| InChI | InChI=1S/C14H21NO3/c1-17-12(16)5-3-2-4-11-13-9-6-7-10(8-9)14(13)18-15-11/h9-10,13-14H,2-8H2,1H3/t9-,10+,13-,14-/m0/s1 |
| InChIKey | QMCGCIQOOZKLGM-DJBIQUGXSA-N |
| XLogP | 2.52 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|