C14H21NO5 — CID 23239270
methyl 5-[(3'aS,6'aS)-spiro[1,3-dioxolane-2,4'-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazole]-3'-yl]pentanoate (PubChem CID 23239270) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is methyl 5-[(3'aS,6'aS)-spiro[1,3-dioxolane-2,4'-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazole]-3'-yl]pentanoate.
| Compound Name | methyl 5-[(3'aS,6'aS)-spiro[1,3-dioxolane-2,4'-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazole]-3'-yl]pentanoate |
|---|---|
| PubChem CID | 23239270 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | methyl 5-[(3'aS,6'aS)-spiro[1,3-dioxolane-2,4'-3a,5,6,6a-tetrahydrocyclopenta[d][1,2]oxazole]-3'-yl]pentanoate |
| SMILES | COC(=O)CCCCC1=NO[C@H]2CCC3(OCCO3)[C@@H]12 |
| InChI | InChI=1S/C14H21NO5/c1-17-12(16)5-3-2-4-10-13-11(20-15-10)6-7-14(13)18-8-9-19-14/h11,13H,2-9H2,1H3/t11-,13-/m0/s1 |
| InChIKey | BGDYNWQZKUXGHV-AAEUAGOBSA-N |
| XLogP | 1.63 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|