C20H27NO3 — CID 11255957
methyl 6-[(1S,2S,3S,4R)-3-anilino-2-bicyclo[2.2.1]heptanyl]-6-oxohexanoate (PubChem CID 11255957) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is methyl 6-[(1S,2S,3S,4R)-3-anilino-2-bicyclo[2.2.1]heptanyl]-6-oxohexanoate.
| Compound Name | methyl 6-[(1S,2S,3S,4R)-3-anilino-2-bicyclo[2.2.1]heptanyl]-6-oxohexanoate |
|---|---|
| PubChem CID | 11255957 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | methyl 6-[(1S,2S,3S,4R)-3-anilino-2-bicyclo[2.2.1]heptanyl]-6-oxohexanoate |
| SMILES | COC(=O)CCCCC(=O)[C@H]1[C@H]2CC[C@H](C2)[C@@H]1Nc1ccccc1 |
| InChI | InChI=1S/C20H27NO3/c1-24-18(23)10-6-5-9-17(22)19-14-11-12-15(13-14)20(19)21-16-7-3-2-4-8-16/h2-4,7-8,14-15,19-21H,5-6,9-13H2,1H3/t14-,15+,19+,20-/m0/s1 |
| InChIKey | PATHCUZMJGEBSW-BWMZKYQQSA-N |
| XLogP | 3.82 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|