C23H40O3S — CID 10916280
methyl 7-[(1S,2R,3S,4R)-3-octylsulfanyl-2-bicyclo[2.2.1]heptanyl]-7-oxoheptanoate (PubChem CID 10916280) has the molecular formula C23H40O3S and a molecular weight of 396.64 g/mol. Its IUPAC name is methyl 7-[(1S,2R,3S,4R)-3-octylsulfanyl-2-bicyclo[2.2.1]heptanyl]-7-oxoheptanoate.
| Compound Name | methyl 7-[(1S,2R,3S,4R)-3-octylsulfanyl-2-bicyclo[2.2.1]heptanyl]-7-oxoheptanoate |
|---|---|
| PubChem CID | 10916280 |
| Molecular Formula | C23H40O3S |
| Molecular Weight | 396.64 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | methyl 7-[(1S,2R,3S,4R)-3-octylsulfanyl-2-bicyclo[2.2.1]heptanyl]-7-oxoheptanoate |
| SMILES | CCCCCCCCS[C@H]1[C@@H]2CC[C@@H](C2)[C@@H]1C(=O)CCCCCC(=O)OC |
| InChI | InChI=1S/C23H40O3S/c1-3-4-5-6-7-11-16-27-23-19-15-14-18(17-19)22(23)20(24)12-9-8-10-13-21(25)26-2/h18-19,22-23H,3-17H2,1-2H3/t18-,19+,22+,23-/m0/s1 |
| InChIKey | VAXLGJNVBOHAQZ-CSGUBPAMSA-N |
| XLogP | 6.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.64 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|