C18H13NO2 — CID 102453464
3-phenyl-1-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)prop-2-yn-1-one (PubChem CID 102453464) has the molecular formula C18H13NO2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-phenyl-1-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)prop-2-yn-1-one.
| Compound Name | 3-phenyl-1-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 102453464 |
| Molecular Formula | C18H13NO2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-phenyl-1-(5-phenyl-4,5-dihydro-1,2-oxazol-3-yl)prop-2-yn-1-one |
| SMILES | O=C(C#Cc1ccccc1)C1=NOC(c2ccccc2)C1 |
| InChI | InChI=1S/C18H13NO2/c20-17(12-11-14-7-3-1-4-8-14)16-13-18(21-19-16)15-9-5-2-6-10-15/h1-10,18H,13H2 |
| InChIKey | OIQFTSKYDJENTK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|