C14H12N4O2 — CID 95383127
(5S)-N,N-bis(cyanomethyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide (PubChem CID 95383127) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is (5S)-N,N-bis(cyanomethyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide.
| Compound Name | (5S)-N,N-bis(cyanomethyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 95383127 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (5S)-N,N-bis(cyanomethyl)-5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxamide |
| SMILES | N#CCN(CC#N)C(=O)C1=NO[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C14H12N4O2/c15-6-8-18(9-7-16)14(19)12-10-13(20-17-12)11-4-2-1-3-5-11/h1-5,13H,8-10H2/t13-/m0/s1 |
| InChIKey | WCAMYPBPXQNANG-ZDUSSCGKSA-N |
| XLogP | 1.38 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|