C11H13NO2 — CID 89241299
3-methoxy-5-(4-methylphenyl)-4,5-dihydro-1,2-oxazole (PubChem CID 89241299) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-methoxy-5-(4-methylphenyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 3-methoxy-5-(4-methylphenyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 89241299 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3-methoxy-5-(4-methylphenyl)-4,5-dihydro-1,2-oxazole |
| SMILES | COC1=NOC(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C11H13NO2/c1-8-3-5-9(6-4-8)10-7-11(13-2)12-14-10/h3-6,10H,7H2,1-2H3 |
| InChIKey | PDMMYVALKRNKAG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |