C16H15NO2 — CID 102399279
(5S)-5-(4-methoxyphenyl)-3-phenyl-4,5-dihydro-1,2-oxazole (PubChem CID 102399279) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is (5S)-5-(4-methoxyphenyl)-3-phenyl-4,5-dihydro-1,2-oxazole.
| Compound Name | (5S)-5-(4-methoxyphenyl)-3-phenyl-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 102399279 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | (5S)-5-(4-methoxyphenyl)-3-phenyl-4,5-dihydro-1,2-oxazole |
| SMILES | COc1ccc([C@@H]2CC(c3ccccc3)=NO2)cc1 |
| InChI | InChI=1S/C16H15NO2/c1-18-14-9-7-13(8-10-14)16-11-15(17-19-16)12-5-3-2-4-6-12/h2-10,16H,11H2,1H3/t16-/m0/s1 |
| InChIKey | GVKKSHZCCVBTDR-INIZCTEOSA-N |
| XLogP | 3.56 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |