C16H15NO3 — CID 10612032
2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]phenol (PubChem CID 10612032) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]phenol.
| Compound Name | 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]phenol |
|---|---|
| PubChem CID | 10612032 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-[3-(4-methoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]phenol |
| SMILES | COc1ccc(C2=NOC(c3ccccc3O)C2)cc1 |
| InChI | InChI=1S/C16H15NO3/c1-19-12-8-6-11(7-9-12)14-10-16(20-17-14)13-4-2-3-5-15(13)18/h2-9,16,18H,10H2,1H3 |
| InChIKey | AWGFDVWFUVBIFL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |