C14H17NO — CID 90444099
3-(4-methylphenyl)-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole (PubChem CID 90444099) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is 3-(4-methylphenyl)-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole.
| Compound Name | 3-(4-methylphenyl)-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole |
|---|---|
| PubChem CID | 90444099 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 3-(4-methylphenyl)-3a,4,5,6,7,7a-hexahydro-1,2-benzoxazole |
| SMILES | Cc1ccc(C2=NOC3CCCCC23)cc1 |
| InChI | InChI=1S/C14H17NO/c1-10-6-8-11(9-7-10)14-12-4-2-3-5-13(12)16-15-14/h6-9,12-13H,2-5H2,1H3 |
| InChIKey | CAKATEHDPWRAOH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |