About 5-butyl-3-methoxy-4,5-dihydro-1,2-oxazole
5-butyl-3-methoxy-4,5-dihydro-1,2-oxazole (PubChem CID 13301196) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is 5-butyl-3-methoxy-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 5-butyl-3-methoxy-4,5-dihydro-1,2-oxazole |
| PubChem CID | 13301196 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | 5-butyl-3-methoxy-4,5-dihydro-1,2-oxazole |
| SMILES | CCCCC1CC(OC)=NO1 |
| InChI | InChI=1S/C8H15NO2/c1-3-4-5-7-6-8(10-2)9-11-7/h7H,3-6H2,1-2H3 |
| InChIKey | CBYYIHCDJAAOCA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-butyl-3-methoxy-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-3-methoxy-4,5-dihydro-1,2-oxazole?
The IUPAC name of 5-butyl-3-methoxy-4,5-dihydro-1,2-oxazole (CID 13301196) is 5-butyl-3-methoxy-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 5-butyl-3-methoxy-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 5-butyl-3-methoxy-4,5-dihydro-1,2-oxazole is CCCCC1CC(OC)=NO1.
What is the InChIKey of 5-butyl-3-methoxy-4,5-dihydro-1,2-oxazole?
The InChIKey is CBYYIHCDJAAOCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-3-4-5-7-6-8(10-2)9-11-7/h7H,3-6H2,1-2H3.
What are the key properties of 5-butyl-3-methoxy-4,5-dihydro-1,2-oxazole?
5-butyl-3-methoxy-4,5-dihydro-1,2-oxazole has a molecular weight of 157.21 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-3-methoxy-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 13301196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).