About acetylene;(5R)-3-methyl-5-pentyl-4,5-dihydro-1,2-oxazole
acetylene;(5R)-3-methyl-5-pentyl-4,5-dihydro-1,2-oxazole (PubChem CID 143617767) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is acetylene;(5R)-3-methyl-5-pentyl-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | acetylene;(5R)-3-methyl-5-pentyl-4,5-dihydro-1,2-oxazole |
| PubChem CID | 143617767 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | acetylene;(5R)-3-methyl-5-pentyl-4,5-dihydro-1,2-oxazole |
| SMILES | C#C.CCCCC[C@@H]1CC(C)=NO1 |
| InChI | InChI=1S/C9H17NO.C2H2/c1-3-4-5-6-9-7-8(2)10-11-9;1-2/h9H,3-7H2,1-2H3;1-2H/t9-;/m1./s1 |
| InChIKey | MWXVDWJDJOUWMJ-SBSPUUFOSA-N |
| XLogP | 2.98 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(5R)-3-methyl-5-pentyl-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(5R)-3-methyl-5-pentyl-4,5-dihydro-1,2-oxazole?
The IUPAC name of acetylene;(5R)-3-methyl-5-pentyl-4,5-dihydro-1,2-oxazole (CID 143617767) is acetylene;(5R)-3-methyl-5-pentyl-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for acetylene;(5R)-3-methyl-5-pentyl-4,5-dihydro-1,2-oxazole?
The canonical SMILES for acetylene;(5R)-3-methyl-5-pentyl-4,5-dihydro-1,2-oxazole is C#C.CCCCC[C@@H]1CC(C)=NO1.
What is the InChIKey of acetylene;(5R)-3-methyl-5-pentyl-4,5-dihydro-1,2-oxazole?
The InChIKey is MWXVDWJDJOUWMJ-SBSPUUFOSA-N. The full InChI is InChI=1S/C9H17NO.C2H2/c1-3-4-5-6-9-7-8(2)10-11-9;1-2/h9H,3-7H2,1-2H3;1-2H/t9-;/m1./s1.
What are the key properties of acetylene;(5R)-3-methyl-5-pentyl-4,5-dihydro-1,2-oxazole?
acetylene;(5R)-3-methyl-5-pentyl-4,5-dihydro-1,2-oxazole has a molecular weight of 181.28 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(5R)-3-methyl-5-pentyl-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 143617767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).