C8H13N3O4 — CID 23643402
N-methyl-5-(3-nitropropyl)-4,5-dihydro-1,2-oxazole-3-carboxamide (PubChem CID 23643402) has the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. Its IUPAC name is N-methyl-5-(3-nitropropyl)-4,5-dihydro-1,2-oxazole-3-carboxamide.
| Compound Name | N-methyl-5-(3-nitropropyl)-4,5-dihydro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 23643402 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | N-methyl-5-(3-nitropropyl)-4,5-dihydro-1,2-oxazole-3-carboxamide |
| SMILES | CNC(=O)C1=NOC(CCC[N+](=O)[O-])C1 |
| InChI | InChI=1S/C8H13N3O4/c1-9-8(12)7-5-6(15-10-7)3-2-4-11(13)14/h6H,2-5H2,1H3,(H,9,12) |
| InChIKey | YAYZPNJAQZHFQW-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|