C11H11ClN4O4 — CID 125138515
(5R)-5-[(4-chloro-2-nitroanilino)methyl]-4,5-dihydro-1,2-oxazole-3-carboxamide (PubChem CID 125138515) has the molecular formula C11H11ClN4O4 and a molecular weight of 298.69 g/mol. Its IUPAC name is (5R)-5-[(4-chloro-2-nitroanilino)methyl]-4,5-dihydro-1,2-oxazole-3-carboxamide.
| Compound Name | (5R)-5-[(4-chloro-2-nitroanilino)methyl]-4,5-dihydro-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 125138515 |
| Molecular Formula | C11H11ClN4O4 |
| Molecular Weight | 298.69 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | (5R)-5-[(4-chloro-2-nitroanilino)methyl]-4,5-dihydro-1,2-oxazole-3-carboxamide |
| SMILES | NC(=O)C1=NO[C@@H](CNc2ccc(Cl)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C11H11ClN4O4/c12-6-1-2-8(10(3-6)16(18)19)14-5-7-4-9(11(13)17)15-20-7/h1-3,7,14H,4-5H2,(H2,13,17)/t7-/m1/s1 |
| InChIKey | XFAGNAPMYIZYJJ-SSDOTTSWSA-N |
| XLogP | 1.29 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.69 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|