C13H15NO3 — CID 14616477
3-(5-benzyl-4,5-dihydro-1,2-oxazol-3-yl)propanoic acid (PubChem CID 14616477) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-(5-benzyl-4,5-dihydro-1,2-oxazol-3-yl)propanoic acid.
| Compound Name | 3-(5-benzyl-4,5-dihydro-1,2-oxazol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 14616477 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-(5-benzyl-4,5-dihydro-1,2-oxazol-3-yl)propanoic acid |
| SMILES | O=C(O)CCC1=NOC(Cc2ccccc2)C1 |
| InChI | InChI=1S/C13H15NO3/c15-13(16)7-6-11-9-12(17-14-11)8-10-4-2-1-3-5-10/h1-5,12H,6-9H2,(H,15,16) |
| InChIKey | LGHUGEQXYFDSNN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |