C20H23NO — CID 15445648
5-(2-phenylethyl)-3-(3-phenylpropyl)-4,5-dihydro-1,2-oxazole (PubChem CID 15445648) has the molecular formula C20H23NO and a molecular weight of 293.41 g/mol. Its IUPAC name is 5-(2-phenylethyl)-3-(3-phenylpropyl)-4,5-dihydro-1,2-oxazole.
| Compound Name | 5-(2-phenylethyl)-3-(3-phenylpropyl)-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 15445648 |
| Molecular Formula | C20H23NO |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | 5-(2-phenylethyl)-3-(3-phenylpropyl)-4,5-dihydro-1,2-oxazole |
| SMILES | c1ccc(CCCC2=NOC(CCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H23NO/c1-3-8-17(9-4-1)12-7-13-19-16-20(22-21-19)15-14-18-10-5-2-6-11-18/h1-6,8-11,20H,7,12-16H2 |
| InChIKey | OPYLYDNQWRPCPY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |