C11H13NO — CID 175040461
5-(2-phenylethyl)-4,5-dihydro-1,3-oxazole (PubChem CID 175040461) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 5-(2-phenylethyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 5-(2-phenylethyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 175040461 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 5-(2-phenylethyl)-4,5-dihydro-1,3-oxazole |
| SMILES | C1=NCC(CCc2ccccc2)O1 |
| InChI | InChI=1S/C11H13NO/c1-2-4-10(5-3-1)6-7-11-8-12-9-13-11/h1-5,9,11H,6-8H2 |
| InChIKey | HXBZEKSKNWDBSU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |