About 1-phenyl-2-[(2R,4R)-2-(2-phenylethyl)-1,3-dioxan-4-yl]ethanone
1-phenyl-2-[(2R,4R)-2-(2-phenylethyl)-1,3-dioxan-4-yl]ethanone (PubChem CID 122379036) has the molecular formula C20H22O3
and a molecular weight of 310.39 g/mol. Its IUPAC name is 1-phenyl-2-[(2R,4R)-2-(2-phenylethyl)-1,3-dioxan-4-yl]ethanone.
Molecular Properties
| Compound Name | 1-phenyl-2-[(2R,4R)-2-(2-phenylethyl)-1,3-dioxan-4-yl]ethanone |
| PubChem CID | 122379036 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | 1-phenyl-2-[(2R,4R)-2-(2-phenylethyl)-1,3-dioxan-4-yl]ethanone |
| SMILES | O=C(C[C@H]1CCO[C@@H](CCc2ccccc2)O1)c1ccccc1 |
| InChI | InChI=1S/C20H22O3/c21-19(17-9-5-2-6-10-17)15-18-13-14-22-20(23-18)12-11-16-7-3-1-4-8-16/h1-10,18,20H,11-15H2/t18-,20-/m1/s1 |
| InChIKey | XDWSHAOQEQKVOL-UYAOXDASSA-N |
| XLogP | 4.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenyl-2-[(2R,4R)-2-(2-phenylethyl)-1,3-dioxan-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2-[(2R,4R)-2-(2-phenylethyl)-1,3-dioxan-4-yl]ethanone?
The IUPAC name of 1-phenyl-2-[(2R,4R)-2-(2-phenylethyl)-1,3-dioxan-4-yl]ethanone (CID 122379036) is 1-phenyl-2-[(2R,4R)-2-(2-phenylethyl)-1,3-dioxan-4-yl]ethanone.
What is the SMILES notation for 1-phenyl-2-[(2R,4R)-2-(2-phenylethyl)-1,3-dioxan-4-yl]ethanone?
The canonical SMILES for 1-phenyl-2-[(2R,4R)-2-(2-phenylethyl)-1,3-dioxan-4-yl]ethanone is O=C(C[C@H]1CCO[C@@H](CCc2ccccc2)O1)c1ccccc1.
What is the InChIKey of 1-phenyl-2-[(2R,4R)-2-(2-phenylethyl)-1,3-dioxan-4-yl]ethanone?
The InChIKey is XDWSHAOQEQKVOL-UYAOXDASSA-N. The full InChI is InChI=1S/C20H22O3/c21-19(17-9-5-2-6-10-17)15-18-13-14-22-20(23-18)12-11-16-7-3-1-4-8-16/h1-10,18,20H,11-15H2/t18-,20-/m1/s1.
What are the key properties of 1-phenyl-2-[(2R,4R)-2-(2-phenylethyl)-1,3-dioxan-4-yl]ethanone?
1-phenyl-2-[(2R,4R)-2-(2-phenylethyl)-1,3-dioxan-4-yl]ethanone has a molecular weight of 310.39 g/mol, XLogP of 4.02, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2-[(2R,4R)-2-(2-phenylethyl)-1,3-dioxan-4-yl]ethanone is sourced from PubChem (CID 122379036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).