C16H22O2 — CID 102185556
(2S,4R,6R)-2-(2-phenylethyl)-6-prop-2-enyloxan-4-ol (PubChem CID 102185556) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (2S,4R,6R)-2-(2-phenylethyl)-6-prop-2-enyloxan-4-ol.
| Compound Name | (2S,4R,6R)-2-(2-phenylethyl)-6-prop-2-enyloxan-4-ol |
|---|---|
| PubChem CID | 102185556 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (2S,4R,6R)-2-(2-phenylethyl)-6-prop-2-enyloxan-4-ol |
| SMILES | C=CC[C@@H]1C[C@H](O)C[C@H](CCc2ccccc2)O1 |
| InChI | InChI=1S/C16H22O2/c1-2-6-15-11-14(17)12-16(18-15)10-9-13-7-4-3-5-8-13/h2-5,7-8,14-17H,1,6,9-12H2/t14-,15+,16-/m0/s1 |
| InChIKey | RFOPBUKYVUIRNL-XHSDSOJGSA-N |
| XLogP | 3.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|