C24H28O3 — CID 134940795
methyl 2-[(2S,3R,5R)-2,5-bis(2-phenylethyl)oxolan-3-yl]prop-2-enoate (PubChem CID 134940795) has the molecular formula C24H28O3 and a molecular weight of 364.49 g/mol. Its IUPAC name is methyl 2-[(2S,3R,5R)-2,5-bis(2-phenylethyl)oxolan-3-yl]prop-2-enoate.
| Compound Name | methyl 2-[(2S,3R,5R)-2,5-bis(2-phenylethyl)oxolan-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 134940795 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | methyl 2-[(2S,3R,5R)-2,5-bis(2-phenylethyl)oxolan-3-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@H]1C[C@@H](CCc2ccccc2)O[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C24H28O3/c1-18(24(25)26-2)22-17-21(15-13-19-9-5-3-6-10-19)27-23(22)16-14-20-11-7-4-8-12-20/h3-12,21-23H,1,13-17H2,2H3/t21-,22-,23+/m1/s1 |
| InChIKey | JKNSOJRZOOPMTJ-ZLNRFVROSA-N |
| XLogP | 4.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|