C22H25NO4 — CID 50977390
4-[(2S,4R,6S)-4-acetamido-6-(2-phenylethyl)oxan-2-yl]benzoic acid (PubChem CID 50977390) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-[(2S,4R,6S)-4-acetamido-6-(2-phenylethyl)oxan-2-yl]benzoic acid.
| Compound Name | 4-[(2S,4R,6S)-4-acetamido-6-(2-phenylethyl)oxan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 50977390 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 4-[(2S,4R,6S)-4-acetamido-6-(2-phenylethyl)oxan-2-yl]benzoic acid |
| SMILES | CC(=O)N[C@@H]1C[C@H](CCc2ccccc2)O[C@H](c2ccc(C(=O)O)cc2)C1 |
| InChI | InChI=1S/C22H25NO4/c1-15(24)23-19-13-20(12-7-16-5-3-2-4-6-16)27-21(14-19)17-8-10-18(11-9-17)22(25)26/h2-6,8-11,19-21H,7,12-14H2,1H3,(H,23,24)(H,25,26)/t19-,20+,21+/m1/s1 |
| InChIKey | FFMCGTHYWOTBCZ-HKBOAZHASA-N |
| XLogP | 3.74 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |