C9H17NO2 — CID 178195325
(2R,4S,6R)-2-(aminomethyl)-6-prop-2-enyloxan-4-ol (PubChem CID 178195325) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is (2R,4S,6R)-2-(aminomethyl)-6-prop-2-enyloxan-4-ol.
| Compound Name | (2R,4S,6R)-2-(aminomethyl)-6-prop-2-enyloxan-4-ol |
|---|---|
| PubChem CID | 178195325 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | (2R,4S,6R)-2-(aminomethyl)-6-prop-2-enyloxan-4-ol |
| SMILES | C=CC[C@@H]1C[C@H](O)C[C@H](CN)O1 |
| InChI | InChI=1S/C9H17NO2/c1-2-3-8-4-7(11)5-9(6-10)12-8/h2,7-9,11H,1,3-6,10H2/t7-,8+,9+/m0/s1 |
| InChIKey | FVPKQVVPQCGVPA-DJLDLDEBSA-N |
| XLogP | 0.43 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|