C13H17F3O3 — CID 134858227
[(2R,6S)-2,6-bis(prop-2-enyl)oxan-4-yl] 2,2,2-trifluoroacetate (PubChem CID 134858227) has the molecular formula C13H17F3O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is [(2R,6S)-2,6-bis(prop-2-enyl)oxan-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2R,6S)-2,6-bis(prop-2-enyl)oxan-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 134858227 |
| Molecular Formula | C13H17F3O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | [(2R,6S)-2,6-bis(prop-2-enyl)oxan-4-yl] 2,2,2-trifluoroacetate |
| SMILES | C=CC[C@@H]1CC(OC(=O)C(F)(F)F)C[C@H](CC=C)O1 |
| InChI | InChI=1S/C13H17F3O3/c1-3-5-9-7-11(8-10(18-9)6-4-2)19-12(17)13(14,15)16/h3-4,9-11H,1-2,5-8H2/t9-,10+,11? |
| InChIKey | QHGWTDLKWLJCBQ-ZACCUICWSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|