C14H19NO4S — CID 24761798
2,2-dioxo-6-(2-phenylethyl)-4-prop-2-enyloxathiazinan-5-ol (PubChem CID 24761798) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 2,2-dioxo-6-(2-phenylethyl)-4-prop-2-enyloxathiazinan-5-ol.
| Compound Name | 2,2-dioxo-6-(2-phenylethyl)-4-prop-2-enyloxathiazinan-5-ol |
|---|---|
| PubChem CID | 24761798 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2,2-dioxo-6-(2-phenylethyl)-4-prop-2-enyloxathiazinan-5-ol |
| SMILES | C=CCC1NS(=O)(=O)OC(CCc2ccccc2)C1O |
| InChI | InChI=1S/C14H19NO4S/c1-2-6-12-14(16)13(19-20(17,18)15-12)10-9-11-7-4-3-5-8-11/h2-5,7-8,12-16H,1,6,9-10H2 |
| InChIKey | UHABPAARXCCEST-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|