C13H18O4 — CID 174151377
(2S,4R,5S)-5-(hydroxymethyl)-4-(2-phenylethyl)oxolane-2,3-diol (PubChem CID 174151377) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (2S,4R,5S)-5-(hydroxymethyl)-4-(2-phenylethyl)oxolane-2,3-diol.
| Compound Name | (2S,4R,5S)-5-(hydroxymethyl)-4-(2-phenylethyl)oxolane-2,3-diol |
|---|---|
| PubChem CID | 174151377 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (2S,4R,5S)-5-(hydroxymethyl)-4-(2-phenylethyl)oxolane-2,3-diol |
| SMILES | OC[C@H]1O[C@H](O)C(O)[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C13H18O4/c14-8-11-10(12(15)13(16)17-11)7-6-9-4-2-1-3-5-9/h1-5,10-16H,6-8H2/t10-,11+,12?,13-/m0/s1 |
| InChIKey | FMYGZCDRTDPJNT-HNGCFSAESA-N |
| XLogP | 0.31 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |