C22H32O3 — CID 134164473
[(2R,4R,5R)-4-methyl-3-(2-phenylethyl)-5-prop-2-enyloxolan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 134164473) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is [(2R,4R,5R)-4-methyl-3-(2-phenylethyl)-5-prop-2-enyloxolan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,4R,5R)-4-methyl-3-(2-phenylethyl)-5-prop-2-enyloxolan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134164473 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | [(2R,4R,5R)-4-methyl-3-(2-phenylethyl)-5-prop-2-enyloxolan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=CC[C@H]1O[C@@H](COC(=O)C(C)(C)C)C(CCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C22H32O3/c1-6-10-19-16(2)18(14-13-17-11-8-7-9-12-17)20(25-19)15-24-21(23)22(3,4)5/h6-9,11-12,16,18-20H,1,10,13-15H2,2-5H3/t16-,18?,19-,20+/m1/s1 |
| InChIKey | YUWOXDPZVKOURU-VOBGVNJCSA-N |
| XLogP | 4.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|