C19H30O5 — CID 11782724
[(2R,3S,6R)-3-(2,2-dimethylpropanoyloxy)-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11782724) has the molecular formula C19H30O5 and a molecular weight of 338.44 g/mol. Its IUPAC name is [(2R,3S,6R)-3-(2,2-dimethylpropanoyloxy)-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,6R)-3-(2,2-dimethylpropanoyloxy)-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11782724 |
| Molecular Formula | C19H30O5 |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | [(2R,3S,6R)-3-(2,2-dimethylpropanoyloxy)-6-prop-2-enyl-3,6-dihydro-2H-pyran-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=CC[C@@H]1C=C[C@H](OC(=O)C(C)(C)C)[C@@H](COC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C19H30O5/c1-8-9-13-10-11-14(24-17(21)19(5,6)7)15(23-13)12-22-16(20)18(2,3)4/h8,10-11,13-15H,1,9,12H2,2-7H3/t13-,14+,15-/m1/s1 |
| InChIKey | MBZOJYMDHZIHKB-QLFBSQMISA-N |
| XLogP | 3.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|