C32H53NO9 — CID 10940980
[(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(E)-hex-5-enylideneamino]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 10940980) has the molecular formula C32H53NO9 and a molecular weight of 595.77 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(E)-hex-5-enylideneamino]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(E)-hex-5-enylideneamino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10940980 |
| Molecular Formula | C32H53NO9 |
| Molecular Weight | 595.77 g/mol |
| Exact Mass | 595.37 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(E)-hex-5-enylideneamino]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=CCCC/C=N/[C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C32H53NO9/c1-14-15-16-17-18-33-24-23(42-28(37)32(11,12)13)22(41-27(36)31(8,9)10)21(40-26(35)30(5,6)7)20(39-24)19-38-25(34)29(2,3)4/h14,18,20-24H,1,15-17,19H2,2-13H3/b33-18+/t20-,21+,22+,23-,24-/m1/s1 |
| InChIKey | CKVRLBQHOBNQBY-BERIHFRYSA-N |
| XLogP | 5.60 |
| TPSA | 126.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.77 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|