C36H63NO9 — CID 177406704
[(2R,3S,4S,5R,6R)-6-[(Z)-decylideneamino]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 177406704) has the molecular formula C36H63NO9 and a molecular weight of 653.90 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[(Z)-decylideneamino]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[(Z)-decylideneamino]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 177406704 |
| Molecular Formula | C36H63NO9 |
| Molecular Weight | 653.90 g/mol |
| Exact Mass | 653.45 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[(Z)-decylideneamino]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CCCCCCCCC/C=N\[C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C36H63NO9/c1-14-15-16-17-18-19-20-21-22-37-28-27(46-32(41)36(11,12)13)26(45-31(40)35(8,9)10)25(44-30(39)34(5,6)7)24(43-28)23-42-29(38)33(2,3)4/h22,24-28H,14-21,23H2,1-13H3/b37-22-/t24-,25+,26+,27-,28-/m1/s1 |
| InChIKey | MFIAUUZKXDPWRF-UWEYNYQTSA-N |
| XLogP | 7.39 |
| TPSA | 126.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.90 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|