C41H69NO10 — CID 11377633
[(2R,3S,4S,5R,6R)-6-[(2R)-2-decyl-4-oxo-2,3-dihydropyridin-1-yl]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11377633) has the molecular formula C41H69NO10 and a molecular weight of 736.00 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[(2R)-2-decyl-4-oxo-2,3-dihydropyridin-1-yl]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[(2R)-2-decyl-4-oxo-2,3-dihydropyridin-1-yl]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11377633 |
| Molecular Formula | C41H69NO10 |
| Molecular Weight | 736.00 g/mol |
| Exact Mass | 735.49 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[(2R)-2-decyl-4-oxo-2,3-dihydropyridin-1-yl]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CCCCCCCCCC[C@@H]1CC(=O)C=CN1[C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C41H69NO10/c1-14-15-16-17-18-19-20-21-22-27-25-28(43)23-24-42(27)33-32(52-37(47)41(11,12)13)31(51-36(46)40(8,9)10)30(50-35(45)39(5,6)7)29(49-33)26-48-34(44)38(2,3)4/h23-24,27,29-33H,14-22,25-26H2,1-13H3/t27-,29-,30+,31+,32-,33-/m1/s1 |
| InChIKey | VHWSHLOHALBLFM-BPEQTJDPSA-N |
| XLogP | 7.86 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.00 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|