C38H55NO10 — CID 102188733
[(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(11-oxo-12-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-12-yl)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 102188733) has the molecular formula C38H55NO10 and a molecular weight of 685.85 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(11-oxo-12-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-12-yl)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(11-oxo-12-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-12-yl)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102188733 |
| Molecular Formula | C38H55NO10 |
| Molecular Weight | 685.85 g/mol |
| Exact Mass | 685.38 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(11-oxo-12-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-12-yl)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@H](N2C(=O)CC3Cc4ccccc4C2C3)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C38H55NO10/c1-35(2,3)31(41)45-20-25-27(47-32(42)36(4,5)6)28(48-33(43)37(7,8)9)29(49-34(44)38(10,11)12)30(46-25)39-24-18-21(19-26(39)40)17-22-15-13-14-16-23(22)24/h13-16,21,24-25,27-30H,17-20H2,1-12H3/t21?,24?,25-,27+,28+,29-,30-/m1/s1 |
| InChIKey | YPOGZIJNXVQODD-KWZWNECMSA-N |
| XLogP | 5.71 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.85 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|