C29H46N2O10 — CID 172851340
[(2R,3R,4S,5R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-pyrazol-1-yloxyoxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 172851340) has the molecular formula C29H46N2O10 and a molecular weight of 582.69 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-pyrazol-1-yloxyoxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-pyrazol-1-yloxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 172851340 |
| Molecular Formula | C29H46N2O10 |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-pyrazol-1-yloxyoxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1OC(On2cccn2)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C29H46N2O10/c1-26(2,3)22(32)36-16-17-18(38-23(33)27(4,5)6)19(39-24(34)28(7,8)9)20(40-25(35)29(10,11)12)21(37-17)41-31-15-13-14-30-31/h13-15,17-21H,16H2,1-12H3/t17-,18-,19+,20-,21?/m1/s1 |
| InChIKey | YCLNANQCTKBOJT-AWGDKMGJSA-N |
| XLogP | 3.50 |
| TPSA | 141.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|