C32H48O10 — CID 163902189
[(2R,3R,4R,5S,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(4-hydroxyphenyl)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 163902189) has the molecular formula C32H48O10 and a molecular weight of 592.73 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(4-hydroxyphenyl)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4R,5S,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(4-hydroxyphenyl)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 163902189 |
| Molecular Formula | C32H48O10 |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.32 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(4-hydroxyphenyl)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@H](c2ccc(O)cc2)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C32H48O10/c1-29(2,3)25(34)38-17-20-22(40-26(35)30(4,5)6)24(42-28(37)32(10,11)12)23(41-27(36)31(7,8)9)21(39-20)18-13-15-19(33)16-14-18/h13-16,20-24,33H,17H2,1-12H3/t20-,21+,22-,23+,24+/m1/s1 |
| InChIKey | QKUWLIHUZSICCL-KNOCVWDGSA-N |
| XLogP | 5.30 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|