C34H55NO10 — CID 11342671
[(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(2S,6S)-2-ethenyl-6-methyl-4-oxopiperidin-1-yl]oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11342671) has the molecular formula C34H55NO10 and a molecular weight of 637.81 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(2S,6S)-2-ethenyl-6-methyl-4-oxopiperidin-1-yl]oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(2S,6S)-2-ethenyl-6-methyl-4-oxopiperidin-1-yl]oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11342671 |
| Molecular Formula | C34H55NO10 |
| Molecular Weight | 637.81 g/mol |
| Exact Mass | 637.38 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-[(2S,6S)-2-ethenyl-6-methyl-4-oxopiperidin-1-yl]oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=C[C@@H]1CC(=O)C[C@H](C)N1[C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C34H55NO10/c1-15-20-17-21(36)16-19(2)35(20)26-25(45-30(40)34(12,13)14)24(44-29(39)33(9,10)11)23(43-28(38)32(6,7)8)22(42-26)18-41-27(37)31(3,4)5/h15,19-20,22-26H,1,16-18H2,2-14H3/t19-,20+,22+,23-,24-,25+,26+/m0/s1 |
| InChIKey | HTLRLANGFXGGDT-GFYPELCNSA-N |
| XLogP | 4.78 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.81 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|