C25H45NO7S — CID 102187081
[(2R,3S,4R,5R,6S)-5-amino-6-tert-butylsulfanyl-3,4-bis(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 102187081) has the molecular formula C25H45NO7S and a molecular weight of 503.70 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-amino-6-tert-butylsulfanyl-3,4-bis(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-amino-6-tert-butylsulfanyl-3,4-bis(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102187081 |
| Molecular Formula | C25H45NO7S |
| Molecular Weight | 503.70 g/mol |
| Exact Mass | 503.29 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-amino-6-tert-butylsulfanyl-3,4-bis(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)S[C@@H]1O[C@H](COC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]1N |
| InChI | InChI=1S/C25H45NO7S/c1-22(2,3)19(27)30-13-14-16(32-20(28)23(4,5)6)17(33-21(29)24(7,8)9)15(26)18(31-14)34-25(10,11)12/h14-18H,13,26H2,1-12H3/t14-,15-,16-,17-,18+/m1/s1 |
| InChIKey | DLBBUGOLNJYEHZ-ZKXLYKBJSA-N |
| XLogP | 4.08 |
| TPSA | 114.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.70 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|