C22H35NO9S — CID 102260387
[(2R,3R,4R,5R,6S)-5-acetamido-3-acetyloxy-6-acetylsulfanyl-4-(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 102260387) has the molecular formula C22H35NO9S and a molecular weight of 489.59 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-5-acetamido-3-acetyloxy-6-acetylsulfanyl-4-(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4R,5R,6S)-5-acetamido-3-acetyloxy-6-acetylsulfanyl-4-(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102260387 |
| Molecular Formula | C22H35NO9S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-5-acetamido-3-acetyloxy-6-acetylsulfanyl-4-(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(=O)C(C)(C)C)[C@@H](OC(C)=O)[C@@H](COC(=O)C(C)(C)C)O[C@H]1SC(C)=O |
| InChI | InChI=1S/C22H35NO9S/c1-11(24)23-15-17(32-20(28)22(7,8)9)16(30-12(2)25)14(31-18(15)33-13(3)26)10-29-19(27)21(4,5)6/h14-18H,10H2,1-9H3,(H,23,24)/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | IPGZPRAYNVKLKI-SFFUCWETSA-N |
| XLogP | 1.97 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|