C37H50N4O9 — CID 122378088
[(2R,3R,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(4-quinolin-2-yltriazol-1-yl)oxan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 122378088) has the molecular formula C37H50N4O9 and a molecular weight of 694.83 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(4-quinolin-2-yltriazol-1-yl)oxan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(4-quinolin-2-yltriazol-1-yl)oxan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 122378088 |
| Molecular Formula | C37H50N4O9 |
| Molecular Weight | 694.83 g/mol |
| Exact Mass | 694.36 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tris(2,2-dimethylpropanoyloxy)-6-(4-quinolin-2-yltriazol-1-yl)oxan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1O[C@@H](n2cc(-c3ccc4ccccc4n3)nn2)[C@H](OC(=O)C(C)(C)C)[C@@H](OC(=O)C(C)(C)C)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C37H50N4O9/c1-34(2,3)30(42)46-20-25-26(48-31(43)35(4,5)6)27(49-32(44)36(7,8)9)28(50-33(45)37(10,11)12)29(47-25)41-19-24(39-40-41)23-18-17-21-15-13-14-16-22(21)38-23/h13-19,25-29H,20H2,1-12H3/t25-,26-,27+,28-,29-/m1/s1 |
| InChIKey | GDIDWXKDTIZMNO-XYPQWYOHSA-N |
| XLogP | 5.85 |
| TPSA | 158.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.83 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|