C41H64N4O9 — CID 176753118
[(2R,3R,4S,5R)-3,4,5-tris(2-deuterioheptanoyloxy)-6-(4-pyridin-2-yltriazol-1-yl)oxan-2-yl]methyl 2-deuterioheptanoate (PubChem CID 176753118) has the molecular formula C41H64N4O9 and a molecular weight of 761.01 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-tris(2-deuterioheptanoyloxy)-6-(4-pyridin-2-yltriazol-1-yl)oxan-2-yl]methyl 2-deuterioheptanoate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-tris(2-deuterioheptanoyloxy)-6-(4-pyridin-2-yltriazol-1-yl)oxan-2-yl]methyl 2-deuterioheptanoate |
|---|---|
| PubChem CID | 176753118 |
| Molecular Formula | C41H64N4O9 |
| Molecular Weight | 761.01 g/mol |
| Exact Mass | 760.49 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-tris(2-deuterioheptanoyloxy)-6-(4-pyridin-2-yltriazol-1-yl)oxan-2-yl]methyl 2-deuterioheptanoate |
| SMILES | [2H]C(CCCCC)C(=O)OC[C@H]1OC(n2cc(-c3ccccn3)nn2)[C@H](OC(=O)C([2H])CCCCC)[C@@H](OC(=O)C([2H])CCCCC)[C@@H]1OC(=O)C([2H])CCCCC |
| InChI | InChI=1S/C41H64N4O9/c1-5-9-13-17-24-34(46)50-30-33-38(52-35(47)25-18-14-10-6-2)39(53-36(48)26-19-15-11-7-3)40(54-37(49)27-20-16-12-8-4)41(51-33)45-29-32(43-44-45)31-23-21-22-28-42-31/h21-23,28-29,33,38-41H,5-20,24-27,30H2,1-4H3/t33-,38-,39+,40-,41?/m1/s1/i24D,25D,26D,27D/t24?,25?,26?,27?,33-,38-,39+,40-,41? |
| InChIKey | ORWWDSUUPVATQM-SUSVTQCKSA-N |
| XLogP | 8.40 |
| TPSA | 158.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.01 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|