C32H37N5O9 — CID 71513478
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[4-[(4-butylphenyl)diazenyl]phenyl]triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 71513478) has the molecular formula C32H37N5O9 and a molecular weight of 635.67 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[4-[(4-butylphenyl)diazenyl]phenyl]triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[4-[(4-butylphenyl)diazenyl]phenyl]triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71513478 |
| Molecular Formula | C32H37N5O9 |
| Molecular Weight | 635.67 g/mol |
| Exact Mass | 635.26 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[4-[(4-butylphenyl)diazenyl]phenyl]triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CCCCc1ccc(/N=N/c2ccc(-c3cn([C@@H]4O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]4OC(C)=O)nn3)cc2)cc1 |
| InChI | InChI=1S/C32H37N5O9/c1-6-7-8-23-9-13-25(14-10-23)33-34-26-15-11-24(12-16-26)27-17-37(36-35-27)32-31(45-22(5)41)30(44-21(4)40)29(43-20(3)39)28(46-32)18-42-19(2)38/h9-17,28-32H,6-8,18H2,1-5H3/b34-33+/t28-,29-,30+,31-,32-/m1/s1 |
| InChIKey | XVOVAOIZBVNXMG-LBTNSABHSA-N |
| XLogP | 4.96 |
| TPSA | 169.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.67 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|