C22H26N4O10 — CID 44816687
[3,4,5-triacetyloxy-6-[5-[(4-hydroxyphenyl)methyl]tetrazol-2-yl]oxan-2-yl]methyl acetate (PubChem CID 44816687) has the molecular formula C22H26N4O10 and a molecular weight of 506.47 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-[5-[(4-hydroxyphenyl)methyl]tetrazol-2-yl]oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-[5-[(4-hydroxyphenyl)methyl]tetrazol-2-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 44816687 |
| Molecular Formula | C22H26N4O10 |
| Molecular Weight | 506.47 g/mol |
| Exact Mass | 506.16 |
| IUPAC Name | [3,4,5-triacetyloxy-6-[5-[(4-hydroxyphenyl)methyl]tetrazol-2-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(n2nnc(Cc3ccc(O)cc3)n2)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C22H26N4O10/c1-11(27)32-10-17-19(33-12(2)28)20(34-13(3)29)21(35-14(4)30)22(36-17)26-24-18(23-25-26)9-15-5-7-16(31)8-6-15/h5-8,17,19-22,31H,9-10H2,1-4H3 |
| InChIKey | NULXEIBBPWWXKC-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 178.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.47 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|