C36H36I2N4O10 — CID 102170171
[(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[4-(4-iodo-N-(4-iodophenyl)anilino)phenyl]methoxymethyl]triazol-1-yl]oxan-2-yl]methyl acetate (PubChem CID 102170171) has the molecular formula C36H36I2N4O10 and a molecular weight of 938.51 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[4-(4-iodo-N-(4-iodophenyl)anilino)phenyl]methoxymethyl]triazol-1-yl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[4-(4-iodo-N-(4-iodophenyl)anilino)phenyl]methoxymethyl]triazol-1-yl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102170171 |
| Molecular Formula | C36H36I2N4O10 |
| Molecular Weight | 938.51 g/mol |
| Exact Mass | 938.05 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4,5-triacetyloxy-6-[4-[[4-(4-iodo-N-(4-iodophenyl)anilino)phenyl]methoxymethyl]triazol-1-yl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(COCc3ccc(N(c4ccc(I)cc4)c4ccc(I)cc4)cc3)nn2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C36H36I2N4O10/c1-21(43)48-20-32-33(49-22(2)44)34(50-23(3)45)35(51-24(4)46)36(52-32)41-17-28(39-40-41)19-47-18-25-5-11-29(12-6-25)42(30-13-7-26(37)8-14-30)31-15-9-27(38)10-16-31/h5-17,32-36H,18-20H2,1-4H3/t32-,33+,34+,35-,36-/m1/s1 |
| InChIKey | LXRCXMXAYBXWGE-FGZSBDNFSA-N |
| XLogP | 5.93 |
| TPSA | 157.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 938.51 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|