C25H35ClN4O12 — CID 72702274
tert-butyl 2-[(2-chloroacetyl)-[[1-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]triazol-4-yl]methyl]amino]acetate (PubChem CID 72702274) has the molecular formula C25H35ClN4O12 and a molecular weight of 619.02 g/mol. Its IUPAC name is tert-butyl 2-[(2-chloroacetyl)-[[1-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]triazol-4-yl]methyl]amino]acetate.
| Compound Name | tert-butyl 2-[(2-chloroacetyl)-[[1-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]triazol-4-yl]methyl]amino]acetate |
|---|---|
| PubChem CID | 72702274 |
| Molecular Formula | C25H35ClN4O12 |
| Molecular Weight | 619.02 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | tert-butyl 2-[(2-chloroacetyl)-[[1-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]triazol-4-yl]methyl]amino]acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](n2cc(CN(CC(=O)OC(C)(C)C)C(=O)CCl)nn2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H35ClN4O12/c1-13(31)37-12-18-21(38-14(2)32)22(39-15(3)33)23(40-16(4)34)24(41-18)30-10-17(27-28-30)9-29(19(35)8-26)11-20(36)42-25(5,6)7/h10,18,21-24H,8-9,11-12H2,1-7H3/t18-,21-,22+,23-,24-/m1/s1 |
| InChIKey | XCJMSFDQNJIKJG-REXJZNOJSA-N |
| XLogP | 0.44 |
| TPSA | 191.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.02 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|