C26H38ClN5O11 — CID 72702540
tert-butyl 2-[[1-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]triazol-4-yl]methyl-(3-chloropropanoyl)amino]acetate (PubChem CID 72702540) has the molecular formula C26H38ClN5O11 and a molecular weight of 632.07 g/mol. Its IUPAC name is tert-butyl 2-[[1-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]triazol-4-yl]methyl-(3-chloropropanoyl)amino]acetate.
| Compound Name | tert-butyl 2-[[1-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]triazol-4-yl]methyl-(3-chloropropanoyl)amino]acetate |
|---|---|
| PubChem CID | 72702540 |
| Molecular Formula | C26H38ClN5O11 |
| Molecular Weight | 632.07 g/mol |
| Exact Mass | 631.23 |
| IUPAC Name | tert-butyl 2-[[1-[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]triazol-4-yl]methyl-(3-chloropropanoyl)amino]acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@H]1n1cc(CN(CC(=O)OC(C)(C)C)C(=O)CCCl)nn1 |
| InChI | InChI=1S/C26H38ClN5O11/c1-14(33)28-22-24(41-17(4)36)23(40-16(3)35)19(13-39-15(2)34)42-25(22)32-11-18(29-30-32)10-31(20(37)8-9-27)12-21(38)43-26(5,6)7/h11,19,22-25H,8-10,12-13H2,1-7H3,(H,28,33)/t19-,22-,23-,24-,25-/m1/s1 |
| InChIKey | VCPHJAWCQMXICV-XXLKIAMFSA-N |
| XLogP | 0.41 |
| TPSA | 194.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.07 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|