C28H46N4O12 — CID 11767361
tert-butyl 2-[[2-[[2-[[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]amino]-2-oxoethyl]amino]acetyl]-(2-methylpropyl)amino]acetate (PubChem CID 11767361) has the molecular formula C28H46N4O12 and a molecular weight of 630.69 g/mol. Its IUPAC name is tert-butyl 2-[[2-[[2-[[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]amino]-2-oxoethyl]amino]acetyl]-(2-methylpropyl)amino]acetate.
| Compound Name | tert-butyl 2-[[2-[[2-[[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]amino]-2-oxoethyl]amino]acetyl]-(2-methylpropyl)amino]acetate |
|---|---|
| PubChem CID | 11767361 |
| Molecular Formula | C28H46N4O12 |
| Molecular Weight | 630.69 g/mol |
| Exact Mass | 630.31 |
| IUPAC Name | tert-butyl 2-[[2-[[2-[[(2R,3R,4R,5S,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]amino]-2-oxoethyl]amino]acetyl]-(2-methylpropyl)amino]acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)O[C@H]1NC(=O)CNCC(=O)N(CC(=O)OC(C)(C)C)CC(C)C |
| InChI | InChI=1S/C28H46N4O12/c1-15(2)12-32(13-23(39)44-28(7,8)9)22(38)11-29-10-21(37)31-27-24(30-16(3)33)26(42-19(6)36)25(41-18(5)35)20(43-27)14-40-17(4)34/h15,20,24-27,29H,10-14H2,1-9H3,(H,30,33)(H,31,37)/t20-,24-,25-,26-,27-/m1/s1 |
| InChIKey | SELONVRHSISBLV-WRBNZHCPSA-N |
| XLogP | -0.83 |
| TPSA | 204.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.69 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|