C22H36N2O11 — CID 23241447
tert-butyl (2S,3R)-3-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-2-aminobutanoate (PubChem CID 23241447) has the molecular formula C22H36N2O11 and a molecular weight of 504.53 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-2-aminobutanoate.
| Compound Name | tert-butyl (2S,3R)-3-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-2-aminobutanoate |
|---|---|
| PubChem CID | 23241447 |
| Molecular Formula | C22H36N2O11 |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | tert-butyl (2S,3R)-3-[(2S,3R,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxy-2-aminobutanoate |
| SMILES | CC(=O)N[C@H]1[C@@H](O[C@H](C)[C@H](N)C(=O)OC(C)(C)C)O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C22H36N2O11/c1-10(16(23)20(29)35-22(6,7)8)31-21-17(24-11(2)25)19(33-14(5)28)18(32-13(4)27)15(34-21)9-30-12(3)26/h10,15-19,21H,9,23H2,1-8H3,(H,24,25)/t10-,15-,16+,17-,18+,19-,21+/m1/s1 |
| InChIKey | KYNFKEDUAXIVLH-WFGMWDNASA-N |
| XLogP | -0.28 |
| TPSA | 178.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|